C17H30N4O4 — CID 67735583
9-(6,7-dihydroxy-3,7-dimethyloctyl)-3,7-dimethyl-8H-purine-2,6-dione (PubChem CID 67735583) has the molecular formula C17H30N4O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 9-(6,7-dihydroxy-3,7-dimethyloctyl)-3,7-dimethyl-8H-purine-2,6-dione.
| Compound Name | 9-(6,7-dihydroxy-3,7-dimethyloctyl)-3,7-dimethyl-8H-purine-2,6-dione |
|---|---|
| PubChem CID | 67735583 |
| Molecular Formula | C17H30N4O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 9-(6,7-dihydroxy-3,7-dimethyloctyl)-3,7-dimethyl-8H-purine-2,6-dione |
| SMILES | CC(CCC(O)C(C)(C)O)CCN1CN(C)c2c1n(C)c(=O)[nH]c2=O |
| InChI | InChI=1S/C17H30N4O4/c1-11(6-7-12(22)17(2,3)25)8-9-21-10-19(4)13-14(23)18-16(24)20(5)15(13)21/h11-12,22,25H,6-10H2,1-5H3,(H,18,23,24) |
| InChIKey | JUYOUKYRQLWTNX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |