About 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione
9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione (PubChem CID 67735623) has the molecular formula C14H24N4O3
and a molecular weight of 296.37 g/mol. Its IUPAC name is 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione.
Molecular Properties
| Compound Name | 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione |
| PubChem CID | 67735623 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione |
| SMILES | CCC(O)CCCCN1CN(C)c2c1n(C)c(=O)[nH]c2=O |
| InChI | InChI=1S/C14H24N4O3/c1-4-10(19)7-5-6-8-18-9-16(2)11-12(20)15-14(21)17(3)13(11)18/h10,19H,4-9H2,1-3H3,(H,15,20,21) |
| InChIKey | BRMUXZISSPAZQA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione?
The IUPAC name of 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione (CID 67735623) is 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione.
What is the SMILES notation for 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione?
The canonical SMILES for 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione is CCC(O)CCCCN1CN(C)c2c1n(C)c(=O)[nH]c2=O.
What is the InChIKey of 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione?
The InChIKey is BRMUXZISSPAZQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O3/c1-4-10(19)7-5-6-8-18-9-16(2)11-12(20)15-14(21)17(3)13(11)18/h10,19H,4-9H2,1-3H3,(H,15,20,21).
What are the key properties of 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione?
9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione has a molecular weight of 296.37 g/mol, XLogP of 0.23, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(5-hydroxyheptyl)-3,7-dimethyl-8H-purine-2,6-dione is sourced from PubChem (CID 67735623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).