About 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine
6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine (PubChem CID 67735937) has the molecular formula C17H19ClFN3O5
and a molecular weight of 399.81 g/mol. Its IUPAC name is 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine.
Molecular Properties
| Compound Name | 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine |
| PubChem CID | 67735937 |
| Molecular Formula | C17H19ClFN3O5 |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine |
| SMILES | CC(C)N.COc1cc(OC)nc(C(=O)c2c(F)ccc(Cl)c2C(=O)O)n1 |
| InChI | InChI=1S/C14H10ClFN2O5.C3H9N/c1-22-8-5-9(23-2)18-13(17-8)12(19)11-7(16)4-3-6(15)10(11)14(20)21;1-3(2)4/h3-5H,1-2H3,(H,20,21);3H,4H2,1-2H3 |
| InChIKey | SRMCDJFYUSFGRL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 124.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine?
The IUPAC name of 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine (CID 67735937) is 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine.
What is the SMILES notation for 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine?
The canonical SMILES for 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine is CC(C)N.COc1cc(OC)nc(C(=O)c2c(F)ccc(Cl)c2C(=O)O)n1.
What is the InChIKey of 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine?
The InChIKey is SRMCDJFYUSFGRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClFN2O5.C3H9N/c1-22-8-5-9(23-2)18-13(17-8)12(19)11-7(16)4-3-6(15)10(11)14(20)21;1-3(2)4/h3-5H,1-2H3,(H,20,21);3H,4H2,1-2H3.
What are the key properties of 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine?
6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine has a molecular weight of 399.81 g/mol, XLogP of 2.57, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(4,6-dimethoxypyrimidine-2-carbonyl)-3-fluorobenzoic acid;propan-2-amine is sourced from PubChem (CID 67735937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).