C24H23FN4O5 — CID 67736682
methyl 2-[4-[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]propanoate (PubChem CID 67736682) has the molecular formula C24H23FN4O5 and a molecular weight of 466.47 g/mol. Its IUPAC name is methyl 2-[4-[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]propanoate.
| Compound Name | methyl 2-[4-[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]propanoate |
|---|---|
| PubChem CID | 67736682 |
| Molecular Formula | C24H23FN4O5 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | methyl 2-[4-[6-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-5-fluorobenzotriazol-1-yl]phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1ccc(-n2nnc3cc(F)c(N4C(=O)C5CCCCC5C4=O)cc32)cc1 |
| InChI | InChI=1S/C24H23FN4O5/c1-13(24(32)33-2)34-15-9-7-14(8-10-15)29-21-12-20(18(25)11-19(21)26-27-29)28-22(30)16-5-3-4-6-17(16)23(28)31/h7-13,16-17H,3-6H2,1-2H3 |
| InChIKey | OPMWVSJSCFORES-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|