C18H20N2 — CID 67736845
(15R,19S)-16-methyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaene (PubChem CID 67736845) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (15R,19S)-16-methyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaene.
| Compound Name | (15R,19S)-16-methyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaene |
|---|---|
| PubChem CID | 67736845 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (15R,19S)-16-methyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),16-pentaene |
| SMILES | CC1=Cn2c3c(c4ccccc42)CCN2CCC[C@H]1[C@@H]32 |
| InChI | InChI=1S/C18H20N2/c1-12-11-20-16-7-3-2-5-14(16)15-8-10-19-9-4-6-13(12)17(19)18(15)20/h2-3,5,7,11,13,17H,4,6,8-10H2,1H3/t13-,17+/m1/s1 |
| InChIKey | QXMDUIJPIDBCMY-DYVFJYSZSA-N |
| XLogP | 3.82 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |