About 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid
2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid (PubChem CID 67737279) has the molecular formula C13H23NO2S
and a molecular weight of 257.40 g/mol. Its IUPAC name is 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid.
Molecular Properties
| Compound Name | 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid |
| PubChem CID | 67737279 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid |
| SMILES | CCCCCNC1(C)C=CC=C(C)C1S(=O)O |
| InChI | InChI=1S/C13H23NO2S/c1-4-5-6-10-14-13(3)9-7-8-11(2)12(13)17(15)16/h7-9,12,14H,4-6,10H2,1-3H3,(H,15,16) |
| InChIKey | FVJIQYAMRZGQEB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid?
The IUPAC name of 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid (CID 67737279) is 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid.
What is the SMILES notation for 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid?
The canonical SMILES for 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid is CCCCCNC1(C)C=CC=C(C)C1S(=O)O.
What is the InChIKey of 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid?
The InChIKey is FVJIQYAMRZGQEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2S/c1-4-5-6-10-14-13(3)9-7-8-11(2)12(13)17(15)16/h7-9,12,14H,4-6,10H2,1-3H3,(H,15,16).
What are the key properties of 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid?
2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid has a molecular weight of 257.40 g/mol, XLogP of 2.63, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-6-(pentylamino)cyclohexa-2,4-diene-1-sulfinic acid is sourced from PubChem (CID 67737279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).