About (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol
(3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol (PubChem CID 67737845) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol |
| PubChem CID | 67737845 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol |
| SMILES | CC1=CCC(CO)C=C1N |
| InChI | InChI=1S/C8H13NO/c1-6-2-3-7(5-10)4-8(6)9/h2,4,7,10H,3,5,9H2,1H3 |
| InChIKey | ZCWHRDZRFFQSMO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol?
The IUPAC name of (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol (CID 67737845) is (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol.
What is the SMILES notation for (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol?
The canonical SMILES for (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol is CC1=CCC(CO)C=C1N.
What is the InChIKey of (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol?
The InChIKey is ZCWHRDZRFFQSMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-6-2-3-7(5-10)4-8(6)9/h2,4,7,10H,3,5,9H2,1H3.
What are the key properties of (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol?
(3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol has a molecular weight of 139.20 g/mol, XLogP of 0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-4-methylcyclohexa-2,4-dien-1-yl)methanol is sourced from PubChem (CID 67737845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).