C21H36O9Si — CID 67738334
[(2R,3S,4S,5R)-3,5-diacetyloxy-2-[(1S)-1-prop-2-enoxyethyl]-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate (PubChem CID 67738334) has the molecular formula C21H36O9Si and a molecular weight of 460.60 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,5-diacetyloxy-2-[(1S)-1-prop-2-enoxyethyl]-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate.
| Compound Name | [(2R,3S,4S,5R)-3,5-diacetyloxy-2-[(1S)-1-prop-2-enoxyethyl]-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 67738334 |
| Molecular Formula | C21H36O9Si |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [(2R,3S,4S,5R)-3,5-diacetyloxy-2-[(1S)-1-prop-2-enoxyethyl]-6-(2-trimethylsilylethoxy)oxan-4-yl] acetate |
| SMILES | C=CCO[C@@H](C)[C@H]1OC(OCC[Si](C)(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H36O9Si/c1-9-10-25-13(2)17-18(27-14(3)22)19(28-15(4)23)20(29-16(5)24)21(30-17)26-11-12-31(6,7)8/h9,13,17-21H,1,10-12H2,2-8H3/t13-,17+,18-,19-,20+,21?/m0/s1 |
| InChIKey | HRQRFEOXPPUAQM-UUOJXZORSA-N |
| XLogP | 2.45 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|