C9H12O8 — CID 67738360
(1S,7S,10R,11R)-6,9,10,11-tetrahydroxy-2,8-dioxabicyclo[5.3.1]undecane-3,5-dione (PubChem CID 67738360) has the molecular formula C9H12O8 and a molecular weight of 248.19 g/mol. Its IUPAC name is (1S,7S,10R,11R)-6,9,10,11-tetrahydroxy-2,8-dioxabicyclo[5.3.1]undecane-3,5-dione.
| Compound Name | (1S,7S,10R,11R)-6,9,10,11-tetrahydroxy-2,8-dioxabicyclo[5.3.1]undecane-3,5-dione |
|---|---|
| PubChem CID | 67738360 |
| Molecular Formula | C9H12O8 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (1S,7S,10R,11R)-6,9,10,11-tetrahydroxy-2,8-dioxabicyclo[5.3.1]undecane-3,5-dione |
| SMILES | O=C1CC(=O)C(O)[C@H]2OC(O)[C@H](O)[C@@H](O1)C2O |
| InChI | InChI=1S/C9H12O8/c10-2-1-3(11)16-8-5(13)7(4(2)12)17-9(15)6(8)14/h4-9,12-15H,1H2/t4?,5?,6-,7-,8+,9?/m1/s1 |
| InChIKey | WTKGIGLTWRHMQQ-PNQRVLNPSA-N |
| XLogP | -3.33 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|