About hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine)
hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine) (PubChem CID 67738362) has the molecular formula C18H40N6O4
and a molecular weight of 404.56 g/mol. Its IUPAC name is hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine).
Molecular Properties
| Compound Name | hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine) |
| PubChem CID | 67738362 |
| Molecular Formula | C18H40N6O4 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine) |
| SMILES | NCC[NH+]1CCNCC1.NCC[NH+]1CCNCC1.O=C([O-])CCCCC(=O)[O-] |
| InChI | InChI=1S/2C6H15N3.C6H10O4/c2*7-1-4-9-5-2-8-3-6-9;7-5(8)3-1-2-4-6(9)10/h2*8H,1-7H2;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | LQOHRPMJBSGWOQ-UHFFFAOYSA-N |
| XLogP | -7.09 |
| TPSA | 165.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | -7.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine)?
The IUPAC name of hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine) (CID 67738362) is hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine).
What is the SMILES notation for hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine)?
The canonical SMILES for hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine) is NCC[NH+]1CCNCC1.NCC[NH+]1CCNCC1.O=C([O-])CCCCC(=O)[O-].
What is the InChIKey of hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine)?
The InChIKey is LQOHRPMJBSGWOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H15N3.C6H10O4/c2*7-1-4-9-5-2-8-3-6-9;7-5(8)3-1-2-4-6(9)10/h2*8H,1-7H2;1-4H2,(H,7,8)(H,9,10).
What are the key properties of hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine)?
hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine) has a molecular weight of 404.56 g/mol, XLogP of -7.09, 9 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for hexanedioate;bis(2-piperazin-1-ium-1-ylethanamine) is sourced from PubChem (CID 67738362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).