About 3,4-dihydro-2H-pyrrole-3,4-diol
3,4-dihydro-2H-pyrrole-3,4-diol (PubChem CID 67738401) has the molecular formula C4H7NO2
and a molecular weight of 101.10 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrrole-3,4-diol.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-pyrrole-3,4-diol |
| PubChem CID | 67738401 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.10 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | 3,4-dihydro-2H-pyrrole-3,4-diol |
| SMILES | OC1C=NCC1O |
| InChI | InChI=1S/C4H7NO2/c6-3-1-5-2-4(3)7/h1,3-4,6-7H,2H2 |
| InChIKey | RTVUDPFAUMGQAC-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.10 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dihydro-2H-pyrrole-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-pyrrole-3,4-diol?
The IUPAC name of 3,4-dihydro-2H-pyrrole-3,4-diol (CID 67738401) is 3,4-dihydro-2H-pyrrole-3,4-diol.
What is the SMILES notation for 3,4-dihydro-2H-pyrrole-3,4-diol?
The canonical SMILES for 3,4-dihydro-2H-pyrrole-3,4-diol is OC1C=NCC1O.
What is the InChIKey of 3,4-dihydro-2H-pyrrole-3,4-diol?
The InChIKey is RTVUDPFAUMGQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2/c6-3-1-5-2-4(3)7/h1,3-4,6-7H,2H2.
What are the key properties of 3,4-dihydro-2H-pyrrole-3,4-diol?
3,4-dihydro-2H-pyrrole-3,4-diol has a molecular weight of 101.10 g/mol, XLogP of -1.21, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-pyrrole-3,4-diol is sourced from PubChem (CID 67738401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).