About [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone
[6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone (PubChem CID 67738808) has the molecular formula C23H24N4O
and a molecular weight of 372.47 g/mol. Its IUPAC name is [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone.
Molecular Properties
| Compound Name | [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone |
| PubChem CID | 67738808 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone |
| SMILES | Cc1ccc(-c2cncc(C(=O)c3cccc(N4CCCNCC4)n3)c2)cc1 |
| InChI | InChI=1S/C23H24N4O/c1-17-6-8-18(9-7-17)19-14-20(16-25-15-19)23(28)21-4-2-5-22(26-21)27-12-3-10-24-11-13-27/h2,4-9,14-16,24H,3,10-13H2,1H3 |
| InChIKey | PZBAOHIAZJNRCR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone?
The IUPAC name of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone (CID 67738808) is [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone.
What is the SMILES notation for [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone?
The canonical SMILES for [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone is Cc1ccc(-c2cncc(C(=O)c3cccc(N4CCCNCC4)n3)c2)cc1.
What is the InChIKey of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone?
The InChIKey is PZBAOHIAZJNRCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O/c1-17-6-8-18(9-7-17)19-14-20(16-25-15-19)23(28)21-4-2-5-22(26-21)27-12-3-10-24-11-13-27/h2,4-9,14-16,24H,3,10-13H2,1H3.
What are the key properties of [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone?
[6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone has a molecular weight of 372.47 g/mol, XLogP of 3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,4-diazepan-1-yl)-2-pyridinyl]-[5-(4-methylphenyl)-3-pyridinyl]methanone is sourced from PubChem (CID 67738808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).