About (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate
(4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate (PubChem CID 67739189) has the molecular formula C5H4ClNO3S
and a molecular weight of 193.61 g/mol. Its IUPAC name is (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate |
| PubChem CID | 67739189 |
| Molecular Formula | C5H4ClNO3S |
| Molecular Weight | 193.61 g/mol |
| Exact Mass | 192.96 |
| IUPAC Name | (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate |
| SMILES | Cc1nc(Cl)c(OC(=O)O)s1 |
| InChI | InChI=1S/C5H4ClNO3S/c1-2-7-3(6)4(11-2)10-5(8)9/h1H3,(H,8,9) |
| InChIKey | ULBMUEPISACHEN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate?
The IUPAC name of (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate (CID 67739189) is (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate.
What is the SMILES notation for (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate?
The canonical SMILES for (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate is Cc1nc(Cl)c(OC(=O)O)s1.
What is the InChIKey of (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate?
The InChIKey is ULBMUEPISACHEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClNO3S/c1-2-7-3(6)4(11-2)10-5(8)9/h1H3,(H,8,9).
What are the key properties of (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate?
(4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate has a molecular weight of 193.61 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2-methyl-1,3-thiazol-5-yl) hydrogen carbonate is sourced from PubChem (CID 67739189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).