About 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one
3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one (PubChem CID 67739487) has the molecular formula C8H7ClN4O3S
and a molecular weight of 274.69 g/mol. Its IUPAC name is 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one.
Molecular Properties
| Compound Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one |
| PubChem CID | 67739487 |
| Molecular Formula | C8H7ClN4O3S |
| Molecular Weight | 274.69 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one |
| SMILES | O=C1CNC(=C[N+](=O)[O-])N1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C8H7ClN4O3S/c9-8-11-1-5(17-8)3-12-6(4-13(15)16)10-2-7(12)14/h1,4,10H,2-3H2 |
| InChIKey | YLQPPAQARZKGMS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.69 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one?
The IUPAC name of 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one (CID 67739487) is 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one.
What is the SMILES notation for 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one?
The canonical SMILES for 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one is O=C1CNC(=C[N+](=O)[O-])N1Cc1cnc(Cl)s1.
What is the InChIKey of 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one?
The InChIKey is YLQPPAQARZKGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN4O3S/c9-8-11-1-5(17-8)3-12-6(4-13(15)16)10-2-7(12)14/h1,4,10H,2-3H2.
What are the key properties of 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one?
3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one has a molecular weight of 274.69 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-(nitromethylidene)imidazolidin-4-one is sourced from PubChem (CID 67739487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).