C47H82O8 — CID 67739535
2-benzyl-2-(2-ethylhexyl)hexanedioic acid;2,2-bis(8-methylnonyl)hexanedioic acid (PubChem CID 67739535) has the molecular formula C47H82O8 and a molecular weight of 775.16 g/mol. Its IUPAC name is 2-benzyl-2-(2-ethylhexyl)hexanedioic acid;2,2-bis(8-methylnonyl)hexanedioic acid.
| Compound Name | 2-benzyl-2-(2-ethylhexyl)hexanedioic acid;2,2-bis(8-methylnonyl)hexanedioic acid |
|---|---|
| PubChem CID | 67739535 |
| Molecular Formula | C47H82O8 |
| Molecular Weight | 775.16 g/mol |
| Exact Mass | 774.60 |
| IUPAC Name | 2-benzyl-2-(2-ethylhexyl)hexanedioic acid;2,2-bis(8-methylnonyl)hexanedioic acid |
| SMILES | CC(C)CCCCCCCC(CCCCCCCC(C)C)(CCCC(=O)O)C(=O)O.CCCCC(CC)CC(CCCC(=O)O)(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H50O4.C21H32O4/c1-22(2)16-11-7-5-9-13-19-26(25(29)30,21-15-18-24(27)28)20-14-10-6-8-12-17-23(3)4;1-3-5-10-17(4-2)15-21(20(24)25,14-9-13-19(22)23)16-18-11-7-6-8-12-18/h22-23H,5-21H2,1-4H3,(H,27,28)(H,29,30);6-8,11-12,17H,3-5,9-10,13-16H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | CAJUNJIONMNIDV-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.16 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|