About 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol
3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol (PubChem CID 67739653) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol |
| PubChem CID | 67739653 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol |
| SMILES | CC1COCC(CC(O)CO)O1 |
| InChI | InChI=1S/C8H16O4/c1-6-4-11-5-8(12-6)2-7(10)3-9/h6-10H,2-5H2,1H3 |
| InChIKey | VJIRKTNWXMJOGR-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol?
The IUPAC name of 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol (CID 67739653) is 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol.
What is the SMILES notation for 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol?
The canonical SMILES for 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol is CC1COCC(CC(O)CO)O1.
What is the InChIKey of 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol?
The InChIKey is VJIRKTNWXMJOGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c1-6-4-11-5-8(12-6)2-7(10)3-9/h6-10H,2-5H2,1H3.
What are the key properties of 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol?
3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol has a molecular weight of 176.21 g/mol, XLogP of -0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-methyl-1,4-dioxan-2-yl)propane-1,2-diol is sourced from PubChem (CID 67739653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).