C38H36N2O5 — CID 67741116
1-but-3-enyl-4-[4-[4-(1-but-3-enyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 67741116) has the molecular formula C38H36N2O5 and a molecular weight of 600.72 g/mol. Its IUPAC name is 1-but-3-enyl-4-[4-[4-(1-but-3-enyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 1-but-3-enyl-4-[4-[4-(1-but-3-enyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 67741116 |
| Molecular Formula | C38H36N2O5 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 1-but-3-enyl-4-[4-[4-(1-but-3-enyl-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenoxy]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C=CCCC12C=CC(C1)C1C(=O)N(c3ccc(Oc4ccc(N5C(=O)C6C7C=CC(CCC=C)(C7)C6C5=O)cc4)cc3)C(=O)C12 |
| InChI | InChI=1S/C38H36N2O5/c1-3-5-17-37-19-15-23(21-37)29-31(37)35(43)39(33(29)41)25-7-11-27(12-8-25)45-28-13-9-26(10-14-28)40-34(42)30-24-16-20-38(22-24,18-6-4-2)32(30)36(40)44/h3-4,7-16,19-20,23-24,29-32H,1-2,5-6,17-18,21-22H2 |
| InChIKey | TYQCZUBZAZVXLD-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|