About 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid
2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid (PubChem CID 67741297) has the molecular formula C23H28O6
and a molecular weight of 400.47 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid.
Molecular Properties
| Compound Name | 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid |
| PubChem CID | 67741297 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid |
| SMILES | COC=CC(=O)O.COCCOCOC(C)(C)C#Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H22O3.C4H6O3/c1-19(2,22-15-21-13-12-20-3)11-10-16-8-9-17-6-4-5-7-18(17)14-16;1-7-3-2-4(5)6/h4-9,14H,12-13,15H2,1-3H3;2-3H,1H3,(H,5,6) |
| InChIKey | KWVWGKFXRMORGM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid?
The IUPAC name of 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid (CID 67741297) is 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid.
What is the SMILES notation for 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid?
The canonical SMILES for 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid is COC=CC(=O)O.COCCOCOC(C)(C)C#Cc1ccc2ccccc2c1.
What is the InChIKey of 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid?
The InChIKey is KWVWGKFXRMORGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O3.C4H6O3/c1-19(2,22-15-21-13-12-20-3)11-10-16-8-9-17-6-4-5-7-18(17)14-16;1-7-3-2-4(5)6/h4-9,14H,12-13,15H2,1-3H3;2-3H,1H3,(H,5,6).
What are the key properties of 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid?
2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid has a molecular weight of 400.47 g/mol, XLogP of 3.84, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-methoxyethoxymethoxy)-3-methylbut-1-ynyl]naphthalene;3-methoxyprop-2-enoic acid is sourced from PubChem (CID 67741297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).