About 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid
2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid (PubChem CID 67741328) has the molecular formula C22H16Cl2O3
and a molecular weight of 399.27 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid.
Molecular Properties
| Compound Name | 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid |
| PubChem CID | 67741328 |
| Molecular Formula | C22H16Cl2O3 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid |
| SMILES | COC=CC(=O)O.Clc1ccc(C#Cc2ccc3ccccc3c2)cc1Cl |
| InChI | InChI=1S/C18H10Cl2.C4H6O3/c19-17-10-8-14(12-18(17)20)6-5-13-7-9-15-3-1-2-4-16(15)11-13;1-7-3-2-4(5)6/h1-4,7-12H;2-3H,1H3,(H,5,6) |
| InChIKey | SVXAUKWSVLIOLI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid?
The IUPAC name of 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid (CID 67741328) is 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid.
What is the SMILES notation for 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid?
The canonical SMILES for 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid is COC=CC(=O)O.Clc1ccc(C#Cc2ccc3ccccc3c2)cc1Cl.
What is the InChIKey of 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid?
The InChIKey is SVXAUKWSVLIOLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10Cl2.C4H6O3/c19-17-10-8-14(12-18(17)20)6-5-13-7-9-15-3-1-2-4-16(15)11-13;1-7-3-2-4(5)6/h1-4,7-12H;2-3H,1H3,(H,5,6).
What are the key properties of 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid?
2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid has a molecular weight of 399.27 g/mol, XLogP of 5.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dichlorophenyl)ethynyl]naphthalene;3-methoxyprop-2-enoic acid is sourced from PubChem (CID 67741328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).