C25H34O7 — CID 67741599
[(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-5,6-dioxooxan-2-yl]ethyl]-3,7-dimethyl-6-oxo-2,7,8,8a-tetrahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 67741599) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is [(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-5,6-dioxooxan-2-yl]ethyl]-3,7-dimethyl-6-oxo-2,7,8,8a-tetrahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-5,6-dioxooxan-2-yl]ethyl]-3,7-dimethyl-6-oxo-2,7,8,8a-tetrahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 67741599 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | [(1S,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-5,6-dioxooxan-2-yl]ethyl]-3,7-dimethyl-6-oxo-2,7,8,8a-tetrahydro-1H-naphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1CC(C)=CC2=CC(=O)[C@@H](C)[C@@H](CC[C@@H]3C[C@@H](O)C(=O)C(=O)O3)[C@H]21 |
| InChI | InChI=1S/C25H34O7/c1-6-25(4,5)24(30)32-20-10-13(2)9-15-11-18(26)14(3)17(21(15)20)8-7-16-12-19(27)22(28)23(29)31-16/h9,11,14,16-17,19-21,27H,6-8,10,12H2,1-5H3/t14-,16+,17+,19+,20-,21-/m0/s1 |
| InChIKey | ADAJRKYJJQDESO-QZVSPGABSA-N |
| XLogP | 3.09 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|