C28H36O2S — CID 67741684
(8S,10R,13S,14S)-13-methyl-10-(2-phenylsulfanylethyl)spiro[1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane] (PubChem CID 67741684) has the molecular formula C28H36O2S and a molecular weight of 436.66 g/mol. Its IUPAC name is (8S,10R,13S,14S)-13-methyl-10-(2-phenylsulfanylethyl)spiro[1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane].
| Compound Name | (8S,10R,13S,14S)-13-methyl-10-(2-phenylsulfanylethyl)spiro[1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 67741684 |
| Molecular Formula | C28H36O2S |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | (8S,10R,13S,14S)-13-methyl-10-(2-phenylsulfanylethyl)spiro[1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane] |
| SMILES | C[C@]12CC=C3[C@@H](CCC4=CC5(CC[C@@]43CCSc3ccccc3)OCCO5)[C@@H]1CCC2 |
| InChI | InChI=1S/C28H36O2S/c1-26-12-5-8-24(26)23-10-9-21-20-28(29-17-18-30-28)15-14-27(21,25(23)11-13-26)16-19-31-22-6-3-2-4-7-22/h2-4,6-7,11,20,23-24H,5,8-10,12-19H2,1H3/t23-,24-,26-,27+/m0/s1 |
| InChIKey | PUZLNZUYWBDOLR-LTMODKEVSA-N |
| XLogP | 7.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|