C23H32N2O6SSi — CID 67741716
(4R,5R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3-[(4-nitrophenyl)methylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 67741716) has the molecular formula C23H32N2O6SSi and a molecular weight of 492.67 g/mol. Its IUPAC name is (4R,5R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3-[(4-nitrophenyl)methylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4R,5R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3-[(4-nitrophenyl)methylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 67741716 |
| Molecular Formula | C23H32N2O6SSi |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (4R,5R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methyl-3-[(4-nitrophenyl)methylsulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)C1C(=O)N2C(C(=O)O)=C(SCc3ccc([N+](=O)[O-])cc3)[C@H](C)[C@@H]12 |
| InChI | InChI=1S/C23H32N2O6SSi/c1-13-18-17(14(2)31-33(6,7)23(3,4)5)21(26)24(18)19(22(27)28)20(13)32-12-15-8-10-16(11-9-15)25(29)30/h8-11,13-14,17-18H,12H2,1-7H3,(H,27,28)/t13-,14-,17?,18+/m1/s1 |
| InChIKey | UCOHJQZLRTWTPW-HSADMQBASA-N |
| XLogP | 5.01 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|