C16H19NO2 — CID 67741976
azane;7-(3,4-dimethoxyphenyl)bicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 67741976) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is azane;7-(3,4-dimethoxyphenyl)bicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | azane;7-(3,4-dimethoxyphenyl)bicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 67741976 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | azane;7-(3,4-dimethoxyphenyl)bicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | COc1ccc(C2Cc3ccccc32)cc1OC.N |
| InChI | InChI=1S/C16H16O2.H3N/c1-17-15-8-7-12(10-16(15)18-2)14-9-11-5-3-4-6-13(11)14;/h3-8,10,14H,9H2,1-2H3;1H3 |
| InChIKey | VSXNBJAAVURFKH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 53.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |