About 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine
1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine (PubChem CID 67742529) has the molecular formula C15H33N5
and a molecular weight of 283.46 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine.
Molecular Properties
| Compound Name | 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine |
| PubChem CID | 67742529 |
| Molecular Formula | C15H33N5 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.27 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine |
| SMILES | C1CCNCC1.C1CN2CCN1CC2.C1CNCCN1 |
| InChI | InChI=1S/C6H12N2.C5H11N.C4H10N2/c1-2-8-5-3-7(1)4-6-8;1-2-4-6-5-3-1;1-2-6-4-3-5-1/h1-6H2;6H,1-5H2;5-6H,1-4H2 |
| InChIKey | HKPODOYFDXBVLR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine?
The IUPAC name of 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine (CID 67742529) is 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine.
What is the SMILES notation for 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine?
The canonical SMILES for 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine is C1CCNCC1.C1CN2CCN1CC2.C1CNCCN1.
What is the InChIKey of 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine?
The InChIKey is HKPODOYFDXBVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.C5H11N.C4H10N2/c1-2-8-5-3-7(1)4-6-8;1-2-4-6-5-3-1;1-2-6-4-3-5-1/h1-6H2;6H,1-5H2;5-6H,1-4H2.
What are the key properties of 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine?
1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine has a molecular weight of 283.46 g/mol, XLogP of -0.44, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazabicyclo[2.2.2]octane;piperazine;piperidine is sourced from PubChem (CID 67742529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).