C24H30N4O2 — CID 67742565
1-[5-(1-butoxy-2-methylpropyl)-2-methylphenyl]-5-phenyl-1,2,4-triazole-3-carboxamide (PubChem CID 67742565) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[5-(1-butoxy-2-methylpropyl)-2-methylphenyl]-5-phenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[5-(1-butoxy-2-methylpropyl)-2-methylphenyl]-5-phenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 67742565 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 1-[5-(1-butoxy-2-methylpropyl)-2-methylphenyl]-5-phenyl-1,2,4-triazole-3-carboxamide |
| SMILES | CCCCOC(c1ccc(C)c(-n2nc(C(N)=O)nc2-c2ccccc2)c1)C(C)C |
| InChI | InChI=1S/C24H30N4O2/c1-5-6-14-30-21(16(2)3)19-13-12-17(4)20(15-19)28-24(18-10-8-7-9-11-18)26-23(27-28)22(25)29/h7-13,15-16,21H,5-6,14H2,1-4H3,(H2,25,29) |
| InChIKey | QGDGOUNFDVJKIM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|