About 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline
4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline (PubChem CID 67742579) has the molecular formula C25H30N2
and a molecular weight of 358.53 g/mol. Its IUPAC name is 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline |
| PubChem CID | 67742579 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline |
| SMILES | Cc1cc(-c2ccc(-c3cc(C)c(N)c(C)c3)c(C(C)C)c2)cc(C)c1N |
| InChI | InChI=1S/C25H30N2/c1-14(2)23-13-19(20-9-15(3)24(26)16(4)10-20)7-8-22(23)21-11-17(5)25(27)18(6)12-21/h7-14H,26-27H2,1-6H3 |
| InChIKey | QOWKLNWVNMSSGJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline?
The IUPAC name of 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline (CID 67742579) is 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline.
What is the SMILES notation for 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline?
The canonical SMILES for 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline is Cc1cc(-c2ccc(-c3cc(C)c(N)c(C)c3)c(C(C)C)c2)cc(C)c1N.
What is the InChIKey of 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline?
The InChIKey is QOWKLNWVNMSSGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N2/c1-14(2)23-13-19(20-9-15(3)24(26)16(4)10-20)7-8-22(23)21-11-17(5)25(27)18(6)12-21/h7-14H,26-27H2,1-6H3.
What are the key properties of 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline?
4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline has a molecular weight of 358.53 g/mol, XLogP of 6.54, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-amino-3,5-dimethylphenyl)-3-propan-2-ylphenyl]-2,6-dimethylaniline is sourced from PubChem (CID 67742579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).