C29H36N2O4 — CID 67742649
2-[5-benzhydryl-4-(2,4,5-trimethoxy-N-methylanilino)pyrrolidin-3-yl]ethanol (PubChem CID 67742649) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is 2-[5-benzhydryl-4-(2,4,5-trimethoxy-N-methylanilino)pyrrolidin-3-yl]ethanol.
| Compound Name | 2-[5-benzhydryl-4-(2,4,5-trimethoxy-N-methylanilino)pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 67742649 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 2-[5-benzhydryl-4-(2,4,5-trimethoxy-N-methylanilino)pyrrolidin-3-yl]ethanol |
| SMILES | COc1cc(OC)c(N(C)C2C(CCO)CNC2C(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C29H36N2O4/c1-31(23-17-25(34-3)26(35-4)18-24(23)33-2)29-22(15-16-32)19-30-28(29)27(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,17-18,22,27-30,32H,15-16,19H2,1-4H3 |
| InChIKey | KZYZXPFZNGVFDD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|