C23H26FN3O5 — CID 67743049
9-butoxy-N-[(4-fluorophenyl)methyl]-2-(2-methoxyethyl)-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 67743049) has the molecular formula C23H26FN3O5 and a molecular weight of 443.48 g/mol. Its IUPAC name is 9-butoxy-N-[(4-fluorophenyl)methyl]-2-(2-methoxyethyl)-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | 9-butoxy-N-[(4-fluorophenyl)methyl]-2-(2-methoxyethyl)-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 67743049 |
| Molecular Formula | C23H26FN3O5 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 9-butoxy-N-[(4-fluorophenyl)methyl]-2-(2-methoxyethyl)-1,8-dioxopyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | CCCCOc1c(=O)c(C(=O)NCc2ccc(F)cc2)cn2ccn(CCOC)c(=O)c12 |
| InChI | InChI=1S/C23H26FN3O5/c1-3-4-12-32-21-19-23(30)26(11-13-31-2)9-10-27(19)15-18(20(21)28)22(29)25-14-16-5-7-17(24)8-6-16/h5-10,15H,3-4,11-14H2,1-2H3,(H,25,29) |
| InChIKey | FATHBMAHDBZZFH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|