C18H24N2S — CID 67743173
6-cyclohexa-1,3-dien-1-yl-2-heptylimidazo[2,1-b][1,3]thiazole (PubChem CID 67743173) has the molecular formula C18H24N2S and a molecular weight of 300.47 g/mol. Its IUPAC name is 6-cyclohexa-1,3-dien-1-yl-2-heptylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-cyclohexa-1,3-dien-1-yl-2-heptylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 67743173 |
| Molecular Formula | C18H24N2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 6-cyclohexa-1,3-dien-1-yl-2-heptylimidazo[2,1-b][1,3]thiazole |
| SMILES | CCCCCCCc1cn2cc(C3=CC=CCC3)nc2s1 |
| InChI | InChI=1S/C18H24N2S/c1-2-3-4-5-9-12-16-13-20-14-17(19-18(20)21-16)15-10-7-6-8-11-15/h6-7,10,13-14H,2-5,8-9,11-12H2,1H3 |
| InChIKey | GRYYCQKAKHZSRJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|