C10H18N2S — CID 67743177
6-pentyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 67743177) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 6-pentyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-pentyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 67743177 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 6-pentyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CCCCCC1CN2CCSC2=N1 |
| InChI | InChI=1S/C10H18N2S/c1-2-3-4-5-9-8-12-6-7-13-10(12)11-9/h9H,2-8H2,1H3 |
| InChIKey | HHMOKCGBYRUYOQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|