C15H15N3O9 — CID 67743187
2-[3,5-bis(1-carboxyprop-2-enyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]but-3-enoic acid (PubChem CID 67743187) has the molecular formula C15H15N3O9 and a molecular weight of 381.30 g/mol. Its IUPAC name is 2-[3,5-bis(1-carboxyprop-2-enyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]but-3-enoic acid.
| Compound Name | 2-[3,5-bis(1-carboxyprop-2-enyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]but-3-enoic acid |
|---|---|
| PubChem CID | 67743187 |
| Molecular Formula | C15H15N3O9 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-[3,5-bis(1-carboxyprop-2-enyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]but-3-enoic acid |
| SMILES | C=CC(C(=O)O)n1c(=O)n(C(C=C)C(=O)O)c(=O)n(C(C=C)C(=O)O)c1=O |
| InChI | InChI=1S/C15H15N3O9/c1-4-7(10(19)20)16-13(25)17(8(5-2)11(21)22)15(27)18(14(16)26)9(6-3)12(23)24/h4-9H,1-3H2,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | FITYTXSAXARCCF-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 177.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|