About N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine
N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine (PubChem CID 67743680) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine |
| PubChem CID | 67743680 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine |
| SMILES | c1coc(N(C(C2CC2)C2CC2)C(C2CC2)C2CC2)n1 |
| InChI | InChI=1S/C17H24N2O/c1-2-11(1)15(12-3-4-12)19(17-18-9-10-20-17)16(13-5-6-13)14-7-8-14/h9-16H,1-8H2 |
| InChIKey | NGHYJUMHDAZUPX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine?
The IUPAC name of N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine (CID 67743680) is N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine.
What is the SMILES notation for N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine?
The canonical SMILES for N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine is c1coc(N(C(C2CC2)C2CC2)C(C2CC2)C2CC2)n1.
What is the InChIKey of N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine?
The InChIKey is NGHYJUMHDAZUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O/c1-2-11(1)15(12-3-4-12)19(17-18-9-10-20-17)16(13-5-6-13)14-7-8-14/h9-16H,1-8H2.
What are the key properties of N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine?
N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine has a molecular weight of 272.39 g/mol, XLogP of 3.86, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(dicyclopropylmethyl)-1,3-oxazol-2-amine is sourced from PubChem (CID 67743680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).