About 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine
4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine (PubChem CID 67743714) has the molecular formula C15H21Cl2NO
and a molecular weight of 302.25 g/mol. Its IUPAC name is 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine.
Molecular Properties
| Compound Name | 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine |
| PubChem CID | 67743714 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine |
| SMILES | CC(C)(C)C1CCC(Oc2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C15H21Cl2NO/c1-15(2,3)10-4-6-11(7-5-10)19-14-12(16)8-18-9-13(14)17/h8-11H,4-7H2,1-3H3 |
| InChIKey | NAVLUVXYXZEPGP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine?
The IUPAC name of 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine (CID 67743714) is 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine.
What is the SMILES notation for 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine?
The canonical SMILES for 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine is CC(C)(C)C1CCC(Oc2c(Cl)cncc2Cl)CC1.
What is the InChIKey of 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine?
The InChIKey is NAVLUVXYXZEPGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Cl2NO/c1-15(2,3)10-4-6-11(7-5-10)19-14-12(16)8-18-9-13(14)17/h8-11H,4-7H2,1-3H3.
What are the key properties of 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine?
4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine has a molecular weight of 302.25 g/mol, XLogP of 5.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-tert-butylcyclohexyl)oxy-3,5-dichloropyridine is sourced from PubChem (CID 67743714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).