C17H21Cl2N5OSi — CID 67743815
[2-(2,4-dichlorophenyl)-1-(1H-imidazol-2-yl)-3-(1H-1,2,4-triazol-5-yl)propan-2-yl]oxy-trimethylsilane (PubChem CID 67743815) has the molecular formula C17H21Cl2N5OSi and a molecular weight of 410.38 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-1-(1H-imidazol-2-yl)-3-(1H-1,2,4-triazol-5-yl)propan-2-yl]oxy-trimethylsilane.
| Compound Name | [2-(2,4-dichlorophenyl)-1-(1H-imidazol-2-yl)-3-(1H-1,2,4-triazol-5-yl)propan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 67743815 |
| Molecular Formula | C17H21Cl2N5OSi |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-1-(1H-imidazol-2-yl)-3-(1H-1,2,4-triazol-5-yl)propan-2-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC(Cc1ncc[nH]1)(Cc1ncn[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H21Cl2N5OSi/c1-26(2,3)25-17(9-15-20-6-7-21-15,10-16-22-11-23-24-16)13-5-4-12(18)8-14(13)19/h4-8,11H,9-10H2,1-3H3,(H,20,21)(H,22,23,24) |
| InChIKey | GGEKLYOLVUUQRL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|