C25H48O3Si — CID 67744321
(1S)-7a-methyl-1-[2-methyl-1-(2-propyl-2-trimethylsilyloxypentoxy)propan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 67744321) has the molecular formula C25H48O3Si and a molecular weight of 424.74 g/mol. Its IUPAC name is (1S)-7a-methyl-1-[2-methyl-1-(2-propyl-2-trimethylsilyloxypentoxy)propan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1S)-7a-methyl-1-[2-methyl-1-(2-propyl-2-trimethylsilyloxypentoxy)propan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 67744321 |
| Molecular Formula | C25H48O3Si |
| Molecular Weight | 424.74 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | (1S)-7a-methyl-1-[2-methyl-1-(2-propyl-2-trimethylsilyloxypentoxy)propan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CCCC(CCC)(COCC(C)(C)[C@H]1CCC2C(=O)CCCC21C)O[Si](C)(C)C |
| InChI | InChI=1S/C25H48O3Si/c1-9-15-25(16-10-2,28-29(6,7)8)19-27-18-23(3,4)22-14-13-20-21(26)12-11-17-24(20,22)5/h20,22H,9-19H2,1-8H3/t20?,22-,24?/m1/s1 |
| InChIKey | VNVOVDRUTGFNQU-DJSMFCCRSA-N |
| XLogP | 7.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.74 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|