About tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine
tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine (PubChem CID 67744600) has the molecular formula C17H36N4O2
and a molecular weight of 328.50 g/mol. Its IUPAC name is tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine.
Molecular Properties
| Compound Name | tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine |
| PubChem CID | 67744600 |
| Molecular Formula | C17H36N4O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN)CC1.NCC1CCNCC1 |
| InChI | InChI=1S/C11H22N2O2.C6H14N2/c1-11(2,3)15-10(14)13-6-4-9(8-12)5-7-13;7-5-6-1-3-8-4-2-6/h9H,4-8,12H2,1-3H3;6,8H,1-5,7H2 |
| InChIKey | WZIWYAUOBGPYLC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine?
The IUPAC name of tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine (CID 67744600) is tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine.
What is the SMILES notation for tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine?
The canonical SMILES for tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine is CC(C)(C)OC(=O)N1CCC(CN)CC1.NCC1CCNCC1.
What is the InChIKey of tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine?
The InChIKey is WZIWYAUOBGPYLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2.C6H14N2/c1-11(2,3)15-10(14)13-6-4-9(8-12)5-7-13;7-5-6-1-3-8-4-2-6/h9H,4-8,12H2,1-3H3;6,8H,1-5,7H2.
What are the key properties of tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine?
tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine has a molecular weight of 328.50 g/mol, XLogP of 1.54, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(aminomethyl)piperidine-1-carboxylate;piperidin-4-ylmethanamine is sourced from PubChem (CID 67744600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).