About 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one
2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one (PubChem CID 67744989) has the molecular formula C12H17BrO3
and a molecular weight of 289.17 g/mol. Its IUPAC name is 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one |
| PubChem CID | 67744989 |
| Molecular Formula | C12H17BrO3 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one |
| SMILES | CCCCOC1C(=O)C(Br)=CC=C1COC |
| InChI | InChI=1S/C12H17BrO3/c1-3-4-7-16-12-9(8-15-2)5-6-10(13)11(12)14/h5-6,12H,3-4,7-8H2,1-2H3 |
| InChIKey | NUFFKFWGEOYSQC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one?
The IUPAC name of 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one (CID 67744989) is 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one?
The canonical SMILES for 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one is CCCCOC1C(=O)C(Br)=CC=C1COC.
What is the InChIKey of 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one?
The InChIKey is NUFFKFWGEOYSQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrO3/c1-3-4-7-16-12-9(8-15-2)5-6-10(13)11(12)14/h5-6,12H,3-4,7-8H2,1-2H3.
What are the key properties of 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one?
2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one has a molecular weight of 289.17 g/mol, XLogP of 2.61, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-butoxy-5-(methoxymethyl)cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 67744989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).