C18H23NO2 — CID 67745070
3-(2,4-dimethylcyclohexa-2,4-dien-1-yl)-1,3-bis(prop-2-enyl)pyrrolidine-2,4-dione (PubChem CID 67745070) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-(2,4-dimethylcyclohexa-2,4-dien-1-yl)-1,3-bis(prop-2-enyl)pyrrolidine-2,4-dione.
| Compound Name | 3-(2,4-dimethylcyclohexa-2,4-dien-1-yl)-1,3-bis(prop-2-enyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 67745070 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-(2,4-dimethylcyclohexa-2,4-dien-1-yl)-1,3-bis(prop-2-enyl)pyrrolidine-2,4-dione |
| SMILES | C=CCN1CC(=O)C(CC=C)(C2CC=C(C)C=C2C)C1=O |
| InChI | InChI=1S/C18H23NO2/c1-5-9-18(15-8-7-13(3)11-14(15)4)16(20)12-19(10-6-2)17(18)21/h5-7,11,15H,1-2,8-10,12H2,3-4H3 |
| InChIKey | CXPRXZSGGKOIQL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|