About 1-aminoimidazole-2,4-dicarbonitrile
1-aminoimidazole-2,4-dicarbonitrile (PubChem CID 67745184) has the molecular formula C5H3N5
and a molecular weight of 133.11 g/mol. Its IUPAC name is 1-aminoimidazole-2,4-dicarbonitrile.
Molecular Properties
| Compound Name | 1-aminoimidazole-2,4-dicarbonitrile |
| PubChem CID | 67745184 |
| Molecular Formula | C5H3N5 |
| Molecular Weight | 133.11 g/mol |
| Exact Mass | 133.04 |
| IUPAC Name | 1-aminoimidazole-2,4-dicarbonitrile |
| SMILES | N#Cc1cn(N)c(C#N)n1 |
| InChI | InChI=1S/C5H3N5/c6-1-4-3-10(8)5(2-7)9-4/h3H,8H2 |
| InChIKey | QZIHGORYMIIZHK-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.11 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-aminoimidazole-2,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoimidazole-2,4-dicarbonitrile?
The IUPAC name of 1-aminoimidazole-2,4-dicarbonitrile (CID 67745184) is 1-aminoimidazole-2,4-dicarbonitrile.
What is the SMILES notation for 1-aminoimidazole-2,4-dicarbonitrile?
The canonical SMILES for 1-aminoimidazole-2,4-dicarbonitrile is N#Cc1cn(N)c(C#N)n1.
What is the InChIKey of 1-aminoimidazole-2,4-dicarbonitrile?
The InChIKey is QZIHGORYMIIZHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N5/c6-1-4-3-10(8)5(2-7)9-4/h3H,8H2.
What are the key properties of 1-aminoimidazole-2,4-dicarbonitrile?
1-aminoimidazole-2,4-dicarbonitrile has a molecular weight of 133.11 g/mol, XLogP of -0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoimidazole-2,4-dicarbonitrile is sourced from PubChem (CID 67745184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).