About 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide
6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide (PubChem CID 67745445) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide.
Molecular Properties
| Compound Name | 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide |
| PubChem CID | 67745445 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide |
| SMILES | CC1CN(C(=O)CCCCC(N)=O)CCC(C)(C)C1 |
| InChI | InChI=1S/C15H28N2O2/c1-12-10-15(2,3)8-9-17(11-12)14(19)7-5-4-6-13(16)18/h12H,4-11H2,1-3H3,(H2,16,18) |
| InChIKey | HHNRXRAIUXZBQU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide?
The IUPAC name of 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide (CID 67745445) is 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide.
What is the SMILES notation for 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide?
The canonical SMILES for 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide is CC1CN(C(=O)CCCCC(N)=O)CCC(C)(C)C1.
What is the InChIKey of 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide?
The InChIKey is HHNRXRAIUXZBQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O2/c1-12-10-15(2,3)8-9-17(11-12)14(19)7-5-4-6-13(16)18/h12H,4-11H2,1-3H3,(H2,16,18).
What are the key properties of 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide?
6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide has a molecular weight of 268.40 g/mol, XLogP of 2.32, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-6-(3,5,5-trimethylazepan-1-yl)hexanamide is sourced from PubChem (CID 67745445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).