C14H7ClN2O4 — CID 677455
2-(2-chloro-5-nitrophenyl)isoindole-1,3-dione (PubChem CID 677455) has the molecular formula C14H7ClN2O4 and a molecular weight of 302.67 g/mol. Its IUPAC name is 2-(2-chloro-5-nitrophenyl)isoindole-1,3-dione.
| Compound Name | 2-(2-chloro-5-nitrophenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 677455 |
| Molecular Formula | C14H7ClN2O4 |
| Molecular Weight | 302.67 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-(2-chloro-5-nitrophenyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C14H7ClN2O4/c15-11-6-5-8(17(20)21)7-12(11)16-13(18)9-3-1-2-4-10(9)14(16)19/h1-7H |
| InChIKey | CRAINYVWWAWUGM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|