C15H22O4 — CID 67745609
5-pentyl-2,2-bis(prop-2-enyl)-1,3-dioxane-4,6-dione (PubChem CID 67745609) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 5-pentyl-2,2-bis(prop-2-enyl)-1,3-dioxane-4,6-dione.
| Compound Name | 5-pentyl-2,2-bis(prop-2-enyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 67745609 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 5-pentyl-2,2-bis(prop-2-enyl)-1,3-dioxane-4,6-dione |
| SMILES | C=CCC1(CC=C)OC(=O)C(CCCCC)C(=O)O1 |
| InChI | InChI=1S/C15H22O4/c1-4-7-8-9-12-13(16)18-15(10-5-2,11-6-3)19-14(12)17/h5-6,12H,2-4,7-11H2,1H3 |
| InChIKey | RJFTXXVUIQHQJB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|