About 2-(1-fluorocyclohexyl)-1,4-dioxane
2-(1-fluorocyclohexyl)-1,4-dioxane (PubChem CID 67745637) has the molecular formula C10H17FO2
and a molecular weight of 188.24 g/mol. Its IUPAC name is 2-(1-fluorocyclohexyl)-1,4-dioxane.
Molecular Properties
| Compound Name | 2-(1-fluorocyclohexyl)-1,4-dioxane |
| PubChem CID | 67745637 |
| Molecular Formula | C10H17FO2 |
| Molecular Weight | 188.24 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-(1-fluorocyclohexyl)-1,4-dioxane |
| SMILES | FC1(C2COCCO2)CCCCC1 |
| InChI | InChI=1S/C10H17FO2/c11-10(4-2-1-3-5-10)9-8-12-6-7-13-9/h9H,1-8H2 |
| InChIKey | BJYLAGGFAOLAJJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-fluorocyclohexyl)-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-fluorocyclohexyl)-1,4-dioxane?
The IUPAC name of 2-(1-fluorocyclohexyl)-1,4-dioxane (CID 67745637) is 2-(1-fluorocyclohexyl)-1,4-dioxane.
What is the SMILES notation for 2-(1-fluorocyclohexyl)-1,4-dioxane?
The canonical SMILES for 2-(1-fluorocyclohexyl)-1,4-dioxane is FC1(C2COCCO2)CCCCC1.
What is the InChIKey of 2-(1-fluorocyclohexyl)-1,4-dioxane?
The InChIKey is BJYLAGGFAOLAJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17FO2/c11-10(4-2-1-3-5-10)9-8-12-6-7-13-9/h9H,1-8H2.
What are the key properties of 2-(1-fluorocyclohexyl)-1,4-dioxane?
2-(1-fluorocyclohexyl)-1,4-dioxane has a molecular weight of 188.24 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-fluorocyclohexyl)-1,4-dioxane is sourced from PubChem (CID 67745637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).