About cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide
cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide (PubChem CID 67745821) has the molecular formula C4H7FN2O
and a molecular weight of 118.11 g/mol. Its IUPAC name is cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide.
Molecular Properties
| Compound Name | cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide |
| PubChem CID | 67745821 |
| Molecular Formula | C4H7FN2O |
| Molecular Weight | 118.11 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide |
| SMILES | NNC(=O)[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C4H7FN2O/c5-3-1-2(3)4(8)7-6/h2-3H,1,6H2,(H,7,8)/t2-,3+/m1/s1 |
| InChIKey | WFLYJKSCMSXHNF-GBXIJSLDSA-N |
| XLogP | -0.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.11 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide?
The IUPAC name of cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide (CID 67745821) is cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide.
What is the SMILES notation for cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide?
The canonical SMILES for cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide is NNC(=O)[C@@H]1C[C@@H]1F.
What is the InChIKey of cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide?
The InChIKey is WFLYJKSCMSXHNF-GBXIJSLDSA-N. The full InChI is InChI=1S/C4H7FN2O/c5-3-1-2(3)4(8)7-6/h2-3H,1,6H2,(H,7,8)/t2-,3+/m1/s1.
What are the key properties of cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide?
cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide has a molecular weight of 118.11 g/mol, XLogP of -0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-2-fluorocyclopropane-1-carbohydrazide is sourced from PubChem (CID 67745821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).