About benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate
benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate (PubChem CID 67745923) has the molecular formula C15H27NO5Si
and a molecular weight of 329.47 g/mol. Its IUPAC name is benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate.
Molecular Properties
| Compound Name | benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate |
| PubChem CID | 67745923 |
| Molecular Formula | C15H27NO5Si |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate |
| SMILES | CCOC(=O)NCCC[Si](OC)(OC)OC.c1ccccc1 |
| InChI | InChI=1S/C9H21NO5Si.C6H6/c1-5-15-9(11)10-7-6-8-16(12-2,13-3)14-4;1-2-4-6-5-3-1/h5-8H2,1-4H3,(H,10,11);1-6H |
| InChIKey | LYTJFSNSHLHJPD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate?
The IUPAC name of benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate (CID 67745923) is benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate.
What is the SMILES notation for benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate?
The canonical SMILES for benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate is CCOC(=O)NCCC[Si](OC)(OC)OC.c1ccccc1.
What is the InChIKey of benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate?
The InChIKey is LYTJFSNSHLHJPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO5Si.C6H6/c1-5-15-9(11)10-7-6-8-16(12-2,13-3)14-4;1-2-4-6-5-3-1/h5-8H2,1-4H3,(H,10,11);1-6H.
What are the key properties of benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate?
benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate has a molecular weight of 329.47 g/mol, XLogP of 2.69, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ethyl N-(3-trimethoxysilylpropyl)carbamate is sourced from PubChem (CID 67745923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).