C25H28O4S — CID 67746004
(3aS,3bR,4R,9aR,9bS,11aS)-4-(4-methoxyphenyl)sulfanyl-9a,11a-dimethyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-1,7-dione (PubChem CID 67746004) has the molecular formula C25H28O4S and a molecular weight of 424.56 g/mol. Its IUPAC name is (3aS,3bR,4R,9aR,9bS,11aS)-4-(4-methoxyphenyl)sulfanyl-9a,11a-dimethyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-1,7-dione.
| Compound Name | (3aS,3bR,4R,9aR,9bS,11aS)-4-(4-methoxyphenyl)sulfanyl-9a,11a-dimethyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-1,7-dione |
|---|---|
| PubChem CID | 67746004 |
| Molecular Formula | C25H28O4S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (3aS,3bR,4R,9aR,9bS,11aS)-4-(4-methoxyphenyl)sulfanyl-9a,11a-dimethyl-3,3a,3b,4,5,9b,10,11-octahydronaphtho[2,1-e][2]benzofuran-1,7-dione |
| SMILES | COc1ccc(S[C@@H]2CC3=CC(=O)C=C[C@]3(C)[C@H]3CC[C@]4(C)C(=O)OC[C@H]4[C@H]23)cc1 |
| InChI | InChI=1S/C25H28O4S/c1-24-10-8-16(26)12-15(24)13-21(30-18-6-4-17(28-3)5-7-18)22-19(24)9-11-25(2)20(22)14-29-23(25)27/h4-8,10,12,19-22H,9,11,13-14H2,1-3H3/t19-,20-,21+,22+,24-,25-/m0/s1 |
| InChIKey | XNXZBNHDCUGMFH-HDRNILEYSA-N |
| XLogP | 4.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |