About N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide
N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide (PubChem CID 67746020) has the molecular formula C19H16BrN3O2S2
and a molecular weight of 462.39 g/mol. Its IUPAC name is N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide |
| PubChem CID | 67746020 |
| Molecular Formula | C19H16BrN3O2S2 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide |
| SMILES | O=S(=O)(NCCSc1cccc2ncc(Br)n12)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H16BrN3O2S2/c20-17-13-21-18-9-4-10-19(23(17)18)26-12-11-22-27(24,25)16-8-3-6-14-5-1-2-7-15(14)16/h1-10,13,22H,11-12H2 |
| InChIKey | FEISSAMCVFKYOW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide?
The IUPAC name of N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide (CID 67746020) is N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide.
What is the SMILES notation for N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide?
The canonical SMILES for N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide is O=S(=O)(NCCSc1cccc2ncc(Br)n12)c1cccc2ccccc12.
What is the InChIKey of N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide?
The InChIKey is FEISSAMCVFKYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16BrN3O2S2/c20-17-13-21-18-9-4-10-19(23(17)18)26-12-11-22-27(24,25)16-8-3-6-14-5-1-2-7-15(14)16/h1-10,13,22H,11-12H2.
What are the key properties of N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide?
N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide has a molecular weight of 462.39 g/mol, XLogP of 4.32, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-bromoimidazo[1,2-a]pyridin-5-yl)sulfanylethyl]naphthalene-1-sulfonamide is sourced from PubChem (CID 67746020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).