C18H26N2O2 — CID 67746400
(2S,5R)-2-benzyl-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 67746400) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (2S,5R)-2-benzyl-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine.
| Compound Name | (2S,5R)-2-benzyl-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 67746400 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2S,5R)-2-benzyl-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | CCOC1=N[C@H](C(C)C)C(OCC)=N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C18H26N2O2/c1-5-21-17-15(12-14-10-8-7-9-11-14)19-18(22-6-2)16(20-17)13(3)4/h7-11,13,15-16H,5-6,12H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | WGFLUQYJHXLTEN-JKSUJKDBSA-N |
| XLogP | 3.51 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |