C28H45N5O11S — CID 67746590
2-[4,7-bis(carboxymethyl)-10-[2-hydroxy-3-[methylsulfonyl-(2-phenyl-1,3-dioxan-5-yl)amino]propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 67746590) has the molecular formula C28H45N5O11S and a molecular weight of 659.76 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-hydroxy-3-[methylsulfonyl-(2-phenyl-1,3-dioxan-5-yl)amino]propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-hydroxy-3-[methylsulfonyl-(2-phenyl-1,3-dioxan-5-yl)amino]propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 67746590 |
| Molecular Formula | C28H45N5O11S |
| Molecular Weight | 659.76 g/mol |
| Exact Mass | 659.28 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-hydroxy-3-[methylsulfonyl-(2-phenyl-1,3-dioxan-5-yl)amino]propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CS(=O)(=O)N(CC(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)C1COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C28H45N5O11S/c1-45(41,42)33(23-20-43-28(44-21-23)22-5-3-2-4-6-22)16-24(34)15-29-7-9-30(17-25(35)36)11-13-32(19-27(39)40)14-12-31(10-8-29)18-26(37)38/h2-6,23-24,28,34H,7-21H2,1H3,(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | VRDFCQIDYKCTKV-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 200.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.76 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |