C32H31NO3 — CID 67746942
[3-[[2-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]cyclohex-2-en-1-yl]methyl]phenyl] acetate (PubChem CID 67746942) has the molecular formula C32H31NO3 and a molecular weight of 477.60 g/mol. Its IUPAC name is [3-[[2-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]cyclohex-2-en-1-yl]methyl]phenyl] acetate.
| Compound Name | [3-[[2-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]cyclohex-2-en-1-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 67746942 |
| Molecular Formula | C32H31NO3 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | [3-[[2-[4,5-bis(4-methylphenyl)-1,3-oxazol-2-yl]cyclohex-2-en-1-yl]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(CC2CCCC=C2c2nc(-c3ccc(C)cc3)c(-c3ccc(C)cc3)o2)c1 |
| InChI | InChI=1S/C32H31NO3/c1-21-11-15-25(16-12-21)30-31(26-17-13-22(2)14-18-26)36-32(33-30)29-10-5-4-8-27(29)19-24-7-6-9-28(20-24)35-23(3)34/h6-7,9-18,20,27H,4-5,8,19H2,1-3H3 |
| InChIKey | GXGPTUHQONNABR-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|